Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D136095-100mg
|
100mg |
2
|
$47.90
|
|
|
D136095-500mg
|
500mg |
3
|
$213.90
|
|
| Synonyms | NSC61770 | 2,4-DIMETHYL-3-HYDROXY-5-HYDROXYMETHYLPYRIDINE HYDROCHLORIDE | 4-Deoxypyridoxine, HCl | Desoxypyridoxime hydrochloride | 3-Pyridinemethanol, 4,6-dimethyl-5-hydroxy-, hydrochloride | 4-Desoxypyridoxine hydrochloride | SB52336 | SK 591 | 4-DOP hy |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
| Biochemical and Physiological Mechanisms | Vitamin B6 antagonist |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Methylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylpyridines |
| Alternative Parents | Hydroxypyridines Heteroaromatic compounds Azacyclic compounds Primary alcohols Organopnictogen compounds Organonitrogen compounds Hydrochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylpyridine - Hydroxypyridine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylpyridines. These are organic compounds containing a pyridine ring substituted at one or more positions by a methyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504754154 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504754154 |
| IUPAC Name | 5-(hydroxymethyl)-2,4-dimethylpyridin-3-ol;hydrochloride |
| INCHI | InChI=1S/C8H11NO2.ClH/c1-5-7(4-10)3-9-6(2)8(5)11;/h3,10-11H,4H2,1-2H3;1H |
| InChIKey | QZKKOQQIVLXUEI-UHFFFAOYSA-N |
| Smiles | CC1=C(C(=NC=C1CO)C)O.Cl |
| Isomeric SMILES | CC1=C(C(=NC=C1CO)C)O.Cl |
| RTECS | UT4800000 |
| Molecular Weight | 189.64 |
| Reaxy-Rn | 3706481 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3706481&ln= |
| Solubility | Soluble in water; Soluble in Alcohol |
|---|---|
| Melt Point(°C) | 274°C(dec.)(lit.) |
| Molecular Weight | 189.640 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 189.056 Da |
| Monoisotopic Mass | 189.056 Da |
| Topological Polar Surface Area | 53.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 129.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |