Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C171920-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$119.90
|
|
| Synonyms | 4-chloro-6-methylthieno[3,2-d]pyrimidine | 108134-22-1 | 4-CHLORO-6-METHYL-THIENO[3,2-D]PYRIMIDINE | Thieno[3,2-d]pyrimidine, 4-chloro-6-methyl- | SCHEMBL4798991 | DTXSID50546645 | JCFKTBGQKWYJNC-UHFFFAOYSA-N | MFCD17015877 | AKOS016006040 | PB16682 | AS-33444 | 6-methyl-4-chl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Thienopyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thienopyrimidines |
| Alternative Parents | 2,3,5-trisubstituted thiophenes Halopyrimidines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Thienopyrimidine - 2,3,5-trisubstituted thiophene - Halopyrimidine - Pyrimidine - Aryl halide - Aryl chloride - Heteroaromatic compound - Thiophene - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as thienopyrimidines. These are heterocyclic compounds containing a thiophene ring fused to a pyrimidine ring. Thiophene is 5-membered ring consisting of four carbon atoms and one sulfur atom. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-chloro-6-methylthieno[3,2-d]pyrimidine |
|---|---|
| INCHI | InChI=1S/C7H5ClN2S/c1-4-2-5-6(11-4)7(8)10-3-9-5/h2-3H,1H3 |
| InChIKey | JCFKTBGQKWYJNC-UHFFFAOYSA-N |
| Smiles | CC1=CC2=C(S1)C(=NC=N2)Cl |
| Isomeric SMILES | CC1=CC2=C(S1)C(=NC=N2)Cl |
| Molecular Weight | 184.64 |
| Reaxy-Rn | 14334588 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14334588&ln= |
| Molecular Weight | 184.650 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 183.986 Da |
| Monoisotopic Mass | 183.986 Da |
| Topological Polar Surface Area | 54.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |