Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C153837-1g
|
1g |
5
|
$79.90
|
|
|
C153837-5g
|
5g |
1
|
$279.90
|
|
| Synonyms | A813625 | 4-Chloro-3,5-dinitrobenzonitrile | 4-Chloro-3,5-dinitro-benzonitrile | 4-cyano-2,6-dinitrochlorobenzene | J-012496 | SY073888 | EINECS 217-686-4 | AS-81431 | BDBM50101935 | FT-0618058 | InChI=1/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Nitrobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrobenzenes |
| Alternative Parents | Nitroaromatic compounds Benzonitriles Chlorobenzenes Aryl chlorides Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Nitriles Organopnictogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Nitrobenzene - Nitroaromatic compound - Benzonitrile - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Organic nitro compound - C-nitro compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Carbonitrile - Nitrile - Organic oxoazanium - Organic nitrogen compound - Organohalogen compound - Organochloride - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrobenzenes. These are compounds containing a nitrobenzene moiety, which consists of a benzene ring with a carbon bearing a nitro group. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488182195 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488182195 |
| IUPAC Name | 4-chloro-3,5-dinitrobenzonitrile |
| INCHI | InChI=1S/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H |
| InChIKey | SCGDEDHSPCXGEC-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])C#N |
| Isomeric SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])C#N |
| WGK Germany | 3 |
| RTECS | DI2990000 |
| Molecular Weight | 227.56 |
| Reaxy-Rn | 1990451 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1990451&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 19, 2024 | C153837 | |
| Certificate of Analysis | Dec 19, 2024 | C153837 | |
| Certificate of Analysis | Jun 15, 2023 | C153837 | |
| Certificate of Analysis | Jun 15, 2023 | C153837 | |
| Certificate of Analysis | Jun 15, 2023 | C153837 | |
| Certificate of Analysis | Jun 15, 2023 | C153837 |
| Melt Point(°C) | 140 °C |
|---|---|
| Molecular Weight | 227.560 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 226.973 Da |
| Monoisotopic Mass | 226.973 Da |
| Topological Polar Surface Area | 115.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 303.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |