Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C193145-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$10.90
|
|
|
C193145-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$45.90
|
|
Discover 4-Chloro-2-methylpyrimidine-5-carbonitrile by Aladdin Scientific in 97% for only $10.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Chloro-2-methylpyrimidine-5-carbonitrile | 38875-74-0 | MFCD13193459 | 4-Chloro5-cyano-2-methyl pyrimidine | SCHEMBL12726137 | DTXSID80506550 | AMY29084 | AKOS015997007 | SB57405 | AS-30806 | SY058503 | CS-0019172 | FT-0751337 | A853906 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halopyrimidines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Nitriles Azacyclic compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Halopyrimidine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as halopyrimidines. These are aromatic compounds containing a halogen atom linked to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-chloro-2-methylpyrimidine-5-carbonitrile |
|---|---|
| INCHI | InChI=1S/C6H4ClN3/c1-4-9-3-5(2-8)6(7)10-4/h3H,1H3 |
| InChIKey | HBTCIXIDTLGBFM-UHFFFAOYSA-N |
| Smiles | CC1=NC=C(C(=N1)Cl)C#N |
| Isomeric SMILES | CC1=NC=C(C(=N1)Cl)C#N |
| Molecular Weight | 153.57 |
| Reaxy-Rn | 126830 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=126830&ln= |
| Molecular Weight | 153.570 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 153.009 Da |
| Monoisotopic Mass | 153.009 Da |
| Topological Polar Surface Area | 49.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 162.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |