Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B300847-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$54.90
|
|
|
B300847-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$174.90
|
|
| Synonyms | 4-Bromophenyl carbonochloridate | FT-0636568 | DTXSID90412299 | EN300-270968 | 4-Bromophenylcarbonochloridate | AKOS015891075 | IKMNJYGTSSQNSE-UHFFFAOYSA-N | MFCD00013256 | SCHEMBL1268683 | 4-Bromophenyl carbonochloridate;4-Bromophenyl carbonochloridate | |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenoxy compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenoxy compounds |
| Alternative Parents | Bromobenzenes Aryl bromides Organic carbonic acids and derivatives Organochlorides Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Halobenzene - Bromobenzene - Aryl halide - Aryl bromide - Carbonic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organobromide - Organohalogen compound - Carbonyl group - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenoxy compounds. These are aromatic compounds contaning a phenoxy group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4-bromophenyl) carbonochloridate |
|---|---|
| INCHI | InChI=1S/C7H4BrClO2/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4H |
| InChIKey | IKMNJYGTSSQNSE-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1OC(=O)Cl)Br |
| Isomeric SMILES | C1=CC(=CC=C1OC(=O)Cl)Br |
| Molecular Weight | 235.46 |
| Reaxy-Rn | 1867972 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1867972&ln= |
| Sensitivity | Moisture sensitive;light sensitive |
|---|---|
| Molecular Weight | 235.460 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 233.908 Da |
| Monoisotopic Mass | 233.908 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 143.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |