Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B588502-250mg
|
250mg |
3
|
$15.90
|
|
|
B588502-1g
|
1g |
3
|
$50.90
|
|
|
B588502-5g
|
5g |
3
|
$225.90
|
|
| Synonyms | FT-0736068 | 4-Bromo-3,5-bis(trifluoromethyl)aniline | AKOS015835306 | A877113 | 3,5-bis(trifluoromethyl)-4-bromoaniline | AMY28227 | DTXSID80426941 | 4-bromo-3,5-bis-trifluoromethyl aniline | AS-18845 | SCHEMBL3115697 | SY020750 | C8H4BrF6N | MFCD0497375 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Aniline and substituted anilines Bromobenzenes Aryl bromides Primary amines Organofluorides Organobromides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Aniline or substituted anilines - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Alkyl fluoride - Organofluoride - Organobromide - Organohalogen compound - Organonitrogen compound - Primary amine - Hydrocarbon derivative - Organic nitrogen compound - Amine - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-bromo-3,5-bis(trifluoromethyl)aniline |
|---|---|
| INCHI | InChI=1S/C8H4BrF6N/c9-6-4(7(10,11)12)1-3(16)2-5(6)8(13,14)15/h1-2H,16H2 |
| InChIKey | ZMVAVUAHKPGYTF-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C(=C1C(F)(F)F)Br)C(F)(F)F)N |
| Isomeric SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)C(F)(F)F)N |
| Molecular Weight | 308.02 |
| Reaxy-Rn | 20102746 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20102746&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 16, 2023 | B588502 | |
| Certificate of Analysis | Sep 16, 2023 | B588502 | |
| Certificate of Analysis | Sep 16, 2023 | B588502 |
| Sensitivity | light sensitive |
|---|---|
| Molecular Weight | 308.020 g/mol |
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 0 |
| Exact Mass | 306.943 Da |
| Monoisotopic Mass | 306.943 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |