Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B578580-250mg
|
250mg |
6
|
$38.90
|
|
|
B578580-1g
|
1g |
5
|
$100.90
|
|
|
B578580-5g
|
5g |
2
|
$326.90
|
|
| Synonyms | 1197231-94-9 | 1-(4-Bromo-2-(trifluoromethyl)phenyl)ethanone | 1-[4-bromo-2-(trifluoromethyl)phenyl]ethan-1-one | 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone | Ethanone, 1-[4-bromo-2-(trifluoromethyl)phenyl]- | MFCD16839140 | 4'-Bromo-2'-(trifluoromethyl)acetopheno |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Protected from light |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Trifluoromethylbenzenes Acetophenones Benzoyl derivatives Aryl alkyl ketones Bromobenzenes Aryl bromides Organofluorides Organobromides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - Trifluoromethylbenzene - Acetophenone - Benzoyl - Aryl alkyl ketone - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Benzenoid - Hydrocarbon derivative - Alkyl halide - Alkyl fluoride - Organic oxide - Organofluoride - Organohalogen compound - Organobromide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488202049 |
|---|---|
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone |
| INCHI | InChI=1S/C9H6BrF3O/c1-5(14)7-3-2-6(10)4-8(7)9(11,12)13/h2-4H,1H3 |
| InChIKey | FBMIDZPWGMPHMY-UHFFFAOYSA-N |
| Smiles | CC(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
| Isomeric SMILES | CC(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
| Molecular Weight | 267.04 |
| Reaxy-Rn | 30936348 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30936348&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 31, 2023 | B578580 | |
| Certificate of Analysis | Mar 31, 2023 | B578580 | |
| Certificate of Analysis | Mar 31, 2023 | B578580 | |
| Certificate of Analysis | Mar 31, 2023 | B578580 | |
| Certificate of Analysis | Mar 31, 2023 | B578580 | |
| Certificate of Analysis | Mar 31, 2023 | B578580 |
| Sensitivity | light sensitive |
|---|---|
| Molecular Weight | 267.040 g/mol |
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 265.955 Da |
| Monoisotopic Mass | 265.955 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |