Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B186900-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$850.90
|
|
Discover 4-Bromo-1-isopentylpyrazole by Aladdin Scientific in 98% for only $850.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Bromo-1-isopentylpyrazole | 847818-48-8 | 4-Bromo-1-isopentyl-1H-pyrazole | 4-BROMO-1-(3-METHYLBUTYL)PYRAZOLE | 4-Bromo-1-(3-methylbutyl)-1H-pyrazole | DTXSID40631519 | XIB81848 | MFCD12026053 | AKOS010259232 | BS-23218 | CS-0456196 | A863996 | F2147-6942 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Aryl halides |
| Subclass | Aryl bromides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl bromides |
| Alternative Parents | Pyrazoles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl bromide - Heteroaromatic compound - Pyrazole - Azole - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organobromide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl bromides. These are organic compounds containing the acyl bromide functional group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-bromo-1-(3-methylbutyl)pyrazole |
|---|---|
| INCHI | InChI=1S/C8H13BrN2/c1-7(2)3-4-11-6-8(9)5-10-11/h5-7H,3-4H2,1-2H3 |
| InChIKey | PSQJFVJRFQJOBI-UHFFFAOYSA-N |
| Smiles | CC(C)CCN1C=C(C=N1)Br |
| Isomeric SMILES | CC(C)CCN1C=C(C=N1)Br |
| Molecular Weight | 217.1 |
| Reaxy-Rn | 9899752 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9899752&ln= |
| Molecular Weight | 217.110 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 216.026 Da |
| Monoisotopic Mass | 216.026 Da |
| Topological Polar Surface Area | 17.800 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 117.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |