Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B188787-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$207.90
|
|
|
B188787-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$770.90
|
|
Discover 4-Bromo-1-(2-chlorophenyl)-1H-pyrazole by Aladdin Scientific in 98% for only $207.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Bromo-1-(2-chlorophenyl)-1H-pyrazole | 957063-04-6 | 4-bromo-1-(2-chlorophenyl)pyrazole | DTXSID70650334 | MFCD09878407 | AKOS015835007 | BS-24580 | AM20050003 | CS-0205758 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | Chlorobenzenes Aryl chlorides Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Chlorobenzene - Halobenzene - Aryl bromide - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Azacycle - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organochloride - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-bromo-1-(2-chlorophenyl)pyrazole |
|---|---|
| INCHI | InChI=1S/C9H6BrClN2/c10-7-5-12-13(6-7)9-4-2-1-3-8(9)11/h1-6H |
| InChIKey | RIQDFPROYPJJMJ-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C(=C1)N2C=C(C=N2)Br)Cl |
| Isomeric SMILES | C1=CC=C(C(=C1)N2C=C(C=N2)Br)Cl |
| Molecular Weight | 257.5 |
| Reaxy-Rn | 28599040 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28599040&ln= |
| Molecular Weight | 257.510 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 255.94 Da |
| Monoisotopic Mass | 255.94 Da |
| Topological Polar Surface Area | 17.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 179.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |