Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B152382-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$9.90
|
|
|
B152382-5g
|
5g |
5
|
$30.90
|
|
|
B152382-25g
|
25g |
1
|
$76.90
|
|
| Synonyms | B1365 | AC-27866 | 4-phenylmethoxybenzonitrile | 4-(benzyloxy)benzonitrile | SCHEMBL403151 | SY050255 | 4-benzyloxy benzonitrile | AS-44757 | BDBM86781 | Maybridge1_005982 | AB6270 | 4-Benzyloxybenzonitrile | 4-Benzyloxy-benzonitrile | FT-0617665 | AKOS00 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Benzonitriles Alkyl aryl ethers Nitriles Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Benzonitrile - Alkyl aryl ether - Monocyclic benzene moiety - Nitrile - Carbonitrile - Ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Activity Value -log(M) | Mechanism of Action | Activity Reference | Publications (PubMed IDs) |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488190307 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488190307 |
| IUPAC Name | 4-phenylmethoxybenzonitrile |
| INCHI | InChI=1S/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
| InChIKey | UDAOJHAASAWVIQ-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)COC2=CC=C(C=C2)C#N |
| Isomeric SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C#N |
| Molecular Weight | 209.25 |
| Reaxy-Rn | 2372698 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2372698&ln= |
| Melt Point(°C) | 94 °C |
|---|---|
| Molecular Weight | 209.240 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 209.084 Da |
| Monoisotopic Mass | 209.084 Da |
| Topological Polar Surface Area | 33.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 241.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |