Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A175447-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$614.90
|
|
Discover 4-aminopiperidine-2,6-dione hydrochloride by Aladdin Scientific in 97% for only $614.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-aminopiperidine-2,6-dione hydrochloride | 1957235-82-3 | 4-Aminopiperidine-2,6-dione HCl | MFCD30719376 | 4-aminopiperidine-2,6-dione;hydrochloride | SCHEMBL2278643 | VNMYRXMKNMXTDZ-UHFFFAOYSA-N | AKOS037644483 | SB43017 | 4-aminopiperidine-2,6-dionehydrochloride | AS-5378 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinediones |
| Alternative Parents | Delta lactams Aminopiperidines N-unsubstituted carboxylic acid imides Dicarboximides Amino acids and derivatives Azacyclic compounds Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinedione - 4-aminopiperidine - Delta-lactam - Carboxylic acid imide - Dicarboximide - Carboxylic acid imide, n-unsubstituted - Amino acid or derivatives - Lactam - Carboxylic acid derivative - Azacycle - Primary amine - Primary aliphatic amine - Hydrochloride - Amine - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinediones. These are compounds containing a piperidine ring which bears two ketones. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-aminopiperidine-2,6-dione;hydrochloride |
|---|---|
| INCHI | InChI=1S/C5H8N2O2.ClH/c6-3-1-4(8)7-5(9)2-3;/h3H,1-2,6H2,(H,7,8,9);1H |
| InChIKey | VNMYRXMKNMXTDZ-UHFFFAOYSA-N |
| Smiles | C1C(CC(=O)NC1=O)N.Cl |
| Isomeric SMILES | C1C(CC(=O)NC1=O)N.Cl |
| Molecular Weight | 164.59 |
| Reaxy-Rn | 37869796 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=37869796&ln= |
| Molecular Weight | 164.590 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 164.035 Da |
| Monoisotopic Mass | 164.035 Da |
| Topological Polar Surface Area | 72.200 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 139.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |