Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A179875-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,175.90
|
|
Discover 4-Allyl-2-chloro-3-(dimethoxymethyl)pyridine by Aladdin Scientific in 95% for only $1,175.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Allyl-2-chloro-3-(dimethoxymethyl)pyridine | 1186310-69-9 | 2-chloro-3-(dimethoxymethyl)-4-prop-2-enylpyridine | DTXSID201207738 | MFCD12922752 | AKOS015838909 | CS-0441894 | 2-Chloro-3-(dimethoxymethyl)-4-(2-propen-1-yl)pyridine | 4-Allyl-2-chloro-3-(dimethoxymethyl)p |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-halopyridines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-halopyridine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Acetal - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-halopyridines. These are organic compounds containing a pyridine ring substituted at the 2-position by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-3-(dimethoxymethyl)-4-prop-2-enylpyridine |
|---|---|
| INCHI | InChI=1S/C11H14ClNO2/c1-4-5-8-6-7-13-10(12)9(8)11(14-2)15-3/h4,6-7,11H,1,5H2,2-3H3 |
| InChIKey | ACMZFZNXZXPSLQ-UHFFFAOYSA-N |
| Smiles | COC(C1=C(C=CN=C1Cl)CC=C)OC |
| Isomeric SMILES | COC(C1=C(C=CN=C1Cl)CC=C)OC |
| PubChem CID | 46737872 |
| Molecular Weight | 227.7 |
| Molecular Weight | 227.690 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 227.071 Da |
| Monoisotopic Mass | 227.071 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 197.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |