Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D469629-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$345.90
|
|
| Synonyms | 4,6-Dimethoxy-3-methyl-1H-indole | SCHEMBL24825685 | 4,6-DIMETHOXY-3-METHYLINDOLE,97% | DTXSID00505267 | 4,6-Dimethoxy-3-methylindole | 4,6-DIMETHOXY-3-METHYLINDOLE, 97% |
|---|---|
| Specifications & Purity | ≥97% |
| Product Description |
Description Reactant for:Acid-catalyzed reactions with ketonesSynthesis of pyrrolo[1,2-a]indolesSynthesis of indolo[2,3-c]quinolinesNitration and oxidative dimerization reactions with nitric acid |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | 3-alkylindoles |
| Direct Parent | 3-methylindoles |
| Alternative Parents | Anisoles Alkyl aryl ethers Substituted pyrroles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 3-methylindole - Anisole - Phenol ether - Alkyl aryl ether - Benzenoid - Substituted pyrrole - Heteroaromatic compound - Pyrrole - Ether - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 3-methylindoles. These are aromatic heterocyclic compounds that contain an indole moiety substituted at the 3-position with a methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4,6-dimethoxy-3-methyl-1H-indole |
|---|---|
| INCHI | InChI=1S/C11H13NO2/c1-7-6-12-9-4-8(13-2)5-10(14-3)11(7)9/h4-6,12H,1-3H3 |
| InChIKey | JWWAWAORLJVTLE-UHFFFAOYSA-N |
| Smiles | CC1=CNC2=C1C(=CC(=C2)OC)OC |
| Isomeric SMILES | CC1=CNC2=C1C(=CC(=C2)OC)OC |
| WGK Germany | 3 |
| Molecular Weight | 191.23 |
| Reaxy-Rn | 4311552 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4311552&ln= |
| Molecular Weight | 191.230 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 191.095 Da |
| Monoisotopic Mass | 191.095 Da |
| Topological Polar Surface Area | 34.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 198.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |