Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D180226-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,958.90
|
|
Discover 4,6-Dibromobenzooxazole-2-thione by Aladdin Scientific in 96% for only $1,958.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4,6-Dibromobenzooxazole-2-thione | 1215206-48-6 | 4,6-dibromo-3H-1,3-benzoxazole-2-thione | 4,6-Dibromobenzo[d]oxazole-2(3H)-thione | 4,6-Dibromo-1,3-benzoxazole-2(3H)-thione | DTXSID70682074 | MFCD15143581 | AKOS015835455 | 2(3H)-Benzoxazolethione, 4,6-dibromo- | BS-21018 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzoxazoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoxazoles |
| Alternative Parents | Benzenoids Aryl bromides Oxazoles Heteroaromatic compounds Oxacyclic compounds Azacyclic compounds Organosulfur compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzoxazole - Aryl bromide - Aryl halide - Benzenoid - Azole - Heteroaromatic compound - Oxazole - Oxacycle - Azacycle - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoxazoles. These are organic compounds containing a benzene fused to an oxazole ring Oxazole is five-membered aromatic ring with a nitrogen and an oxygen atoms at the 1- and 3-position, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4,6-dibromo-3H-1,3-benzoxazole-2-thione |
|---|---|
| INCHI | InChI=1S/C7H3Br2NOS/c8-3-1-4(9)6-5(2-3)11-7(12)10-6/h1-2H,(H,10,12) |
| InChIKey | CZCGAMAWAYOEJD-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C2=C1OC(=S)N2)Br)Br |
| Isomeric SMILES | C1=C(C=C(C2=C1OC(=S)N2)Br)Br |
| PubChem CID | 53216946 |
| Molecular Weight | 309 |
| Molecular Weight | 308.980 g/mol |
|---|---|
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 308.828 Da |
| Monoisotopic Mass | 306.83 Da |
| Topological Polar Surface Area | 53.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |