Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C186232-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$206.90
|
|
|
C186232-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$598.90
|
|
|
C186232-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,483.90
|
|
Discover 4-(6-Chloropyrazin-2-yl)morpholine by Aladdin Scientific in 98% for only $206.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(6-chloropyrazin-2-yl)morpholine | 720693-19-6 | 4-(6-Chloro-pyrazin-2-yl)morpholine | 4-(6-chloro-2-pyrazinyl)morpholine | MFCD09800998 | 4-(6-Chloro-pyrazin-2-yl)-morpholine | 6-Chloro-6-moropholinopyrazine | SCHEMBL3089415 | DTXSID30650092 | AVZHUCQUCHGNJF-UHFFFAOYSA- |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines - Tertiary alkylarylamines |
| Direct Parent | Dialkylarylamines |
| Alternative Parents | Aminopyrazines Morpholines Imidolactams Aryl chlorides Heteroaromatic compounds Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Dialkylarylamine - Aminopyrazine - Aryl chloride - Aryl halide - Morpholine - Oxazinane - Imidolactam - Pyrazine - Heteroaromatic compound - Oxacycle - Dialkyl ether - Ether - Azacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxygen compound - Organohalogen compound - Organochloride - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkylarylamines. These are aliphatic aromatic amines in which the amino group is linked to two aliphatic chains and one aromatic group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(6-chloropyrazin-2-yl)morpholine |
|---|---|
| INCHI | InChI=1S/C8H10ClN3O/c9-7-5-10-6-8(11-7)12-1-3-13-4-2-12/h5-6H,1-4H2 |
| InChIKey | AVZHUCQUCHGNJF-UHFFFAOYSA-N |
| Smiles | C1COCCN1C2=CN=CC(=N2)Cl |
| Isomeric SMILES | C1COCCN1C2=CN=CC(=N2)Cl |
| Molecular Weight | 199.6 |
| Reaxy-Rn | 1214141 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1214141&ln= |
| Molecular Weight | 199.640 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 199.051 Da |
| Monoisotopic Mass | 199.051 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |