Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D192430-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$13.90
|
|
|
D192430-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$55.90
|
|
|
D192430-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$201.90
|
|
Discover 4,5-Dichloro-2-methylpyrimidine by Aladdin Scientific in 98% for only $13.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4,5-Dichloro-2-methylpyrimidine | 26740-71-6 | MFCD16987924 | SCHEMBL850260 | DTXSID70626731 | AKOS016001616 | CS-W000657 | GS-5628 | SB57820 | SY111603 | FT-0730842 | H10274 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halopyrimidines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Halopyrimidine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as halopyrimidines. These are aromatic compounds containing a halogen atom linked to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4,5-dichloro-2-methylpyrimidine |
|---|---|
| INCHI | InChI=1S/C5H4Cl2N2/c1-3-8-2-4(6)5(7)9-3/h2H,1H3 |
| InChIKey | BBOCHHGADKWQHT-UHFFFAOYSA-N |
| Smiles | CC1=NC=C(C(=N1)Cl)Cl |
| Isomeric SMILES | CC1=NC=C(C(=N1)Cl)Cl |
| Molecular Weight | 163.01 |
| Reaxy-Rn | 907636 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=907636&ln= |
| Molecular Weight | 163.000 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 161.975 Da |
| Monoisotopic Mass | 161.975 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 99.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |