Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D122397-5g
|
5g |
3
|
$92.90
|
|
|
D122397-25g
|
25g |
2
|
$414.90
|
|
| Synonyms | 4,5-dibromopyridazinone | 4,5-dibromo-2,3-dihydropyridazin-3-one | AM20100418 | SCHEMBL709632 | A831661 | NSC38292 | NSC-38292 | FT-0600261 | SY023986 | MFCD00023641 | J-514074 | STL573304 | 4,5-dibromo-1H-pyridazin-6-one | AKOS001379670 | 4,5-Dibromo-3[2 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyridazines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridazinones |
| Alternative Parents | Aryl bromides Vinylogous halides Heteroaromatic compounds Lactams Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridazinone - Aryl bromide - Aryl halide - Vinylogous halide - Heteroaromatic compound - Lactam - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridazinones. These are compounds containing a pyridazine ring which bears a ketone. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4,5-dibromo-1H-pyridazin-6-one |
|---|---|
| INCHI | InChI=1S/C4H2Br2N2O/c5-2-1-7-8-4(9)3(2)6/h1H,(H,8,9) |
| InChIKey | AGLQURQNVJVJNB-UHFFFAOYSA-N |
| Smiles | C1=NNC(=O)C(=C1Br)Br |
| Isomeric SMILES | C1=NNC(=O)C(=C1Br)Br |
| Molecular Weight | 253.89 |
| Beilstein | 121469 |
| Reaxy-Rn | 121469 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=121469&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 16, 2025 | D122397 | |
| Certificate of Analysis | Jun 16, 2025 | D122397 | |
| Certificate of Analysis | Nov 24, 2023 | D122397 | |
| Certificate of Analysis | Nov 24, 2023 | D122397 | |
| Certificate of Analysis | Nov 24, 2023 | D122397 |
| Melt Point(°C) | 220°C |
|---|---|
| Molecular Weight | 253.880 g/mol |
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 253.851 Da |
| Monoisotopic Mass | 251.853 Da |
| Topological Polar Surface Area | 41.500 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 209.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |