Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F185962-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,906.90
|
|
Discover 4-(4-Fluorophenyl)-2,5-dimethylthiazole by Aladdin Scientific in 98% for only $1,906.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(4-Fluorophenyl)-2,5-dimethylthiazole | 675856-63-0 | 4-(4-fluorophenyl)-2,5-dimethyl-1,3-thiazole | SCHEMBL8188473 | DTXSID50392689 | BS-29382 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2,4,5-trisubstituted thiazoles |
| Alternative Parents | Fluorobenzenes Aryl fluorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2,4,5-trisubstituted 1,3-thiazole - Halobenzene - Fluorobenzene - Benzenoid - Monocyclic benzene moiety - Aryl halide - Aryl fluoride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2,4,5-trisubstituted thiazoles. These are compounds containing a thiazole ring substituted at positions 2, 4 and 5 only. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(4-fluorophenyl)-2,5-dimethyl-1,3-thiazole |
|---|---|
| INCHI | InChI=1S/C11H10FNS/c1-7-11(13-8(2)14-7)9-3-5-10(12)6-4-9/h3-6H,1-2H3 |
| InChIKey | BYLRJAPIHKXDNV-UHFFFAOYSA-N |
| Smiles | CC1=C(N=C(S1)C)C2=CC=C(C=C2)F |
| Isomeric SMILES | CC1=C(N=C(S1)C)C2=CC=C(C=C2)F |
| Molecular Weight | 207.3 |
| Reaxy-Rn | 10337892 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10337892&ln= |
| Molecular Weight | 207.270 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 207.052 Da |
| Monoisotopic Mass | 207.052 Da |
| Topological Polar Surface Area | 41.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |