Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D155953-1g
|
1g |
2
|
$25.90
|
|
|
D155953-5g
|
5g |
3
|
$94.90
|
|
|
D155953-25g
|
25g |
3
|
$423.90
|
|
|
D155953-100g
|
100g |
3
|
$1,523.90
|
|
|
D155953-500g
|
500g |
1
|
$6,856.90
|
|
| Synonyms | 4,4-Dimethyl-3,5,8-trioxabicyclo(5.1.0)octane | BCP17091 | EC 421-750-9 | SB40516 | EN300-136272 | AKOS016007973 | CS1776 | AMY5474 | MFCD16621162 | SY053244 | 4,4-dimethyl-3,5,8-trioxabicyclo[5,1,0]octane | 4,4-Dimethyl-3,5,8-trioxabic-yclo[5,1,0]Octane |
|---|---|
| Specifications & Purity | ≥95%(GC) |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Dioxepanes |
| Subclass | 1,3-dioxepanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,3-dioxepanes |
| Alternative Parents | Ketals Oxacyclic compounds Epoxides Dialkyl ethers Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Ketal - 1,3-dioxepane - Oxacycle - Ether - Oxirane - Dialkyl ether - Acetal - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,3-dioxepanes. These are dioxepanes with the two ring oxygen atoms at position 1 and 3, respectively. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504765989 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504765989 |
| IUPAC Name | 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane |
| INCHI | InChI=1S/C7H12O3/c1-7(2)8-3-5-6(10-5)4-9-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | GEKNCWQQNMEIMS-UHFFFAOYSA-N |
| Smiles | CC1(OCC2C(O2)CO1)C |
| Isomeric SMILES | CC1(OCC2C(O2)CO1)C |
| Alternate CAS | 57280-22-5 |
| Molecular Weight | 144.17 |
| Reaxy-Rn | 1362449 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1362449&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 07, 2025 | D155953 | |
| Certificate of Analysis | Jan 07, 2025 | D155953 | |
| Certificate of Analysis | Sep 16, 2022 | D155953 | |
| Certificate of Analysis | Jan 21, 2022 | D155953 | |
| Certificate of Analysis | Jan 21, 2022 | D155953 | |
| Certificate of Analysis | Jan 21, 2022 | D155953 | |
| Certificate of Analysis | Jan 21, 2022 | D155953 |
| Sensitivity | Heat&Air sensitive |
|---|---|
| Refractive Index | 1.58 |
| Boil Point(°C) | 86 °C/15 mmHg |
| Molecular Weight | 144.170 g/mol |
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 144.079 Da |
| Monoisotopic Mass | 144.079 Da |
| Topological Polar Surface Area | 31.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 130.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |