Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D155812-250mg
|
250mg |
3
|
$132.90
|
|
|
D155812-1g
|
1g |
3
|
$407.90
|
|
| Synonyms | 4-HEXYL-2-(4-HEXYLTHIOPHEN-2-YL)THIOPHENE | DTXSID60573861 | AS-59864 | T70228 | SCHEMBL196514 | D4182 | 4,4'-dihexyl-2,2'-bithiophene | MFCD28386097 | AKOS037645294 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Bi- and oligothiophenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bi- and oligothiophenes |
| Alternative Parents | Thiophenes Heteroaromatic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Bithiophene - Heteroaromatic compound - Thiophene - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as bi- and oligothiophenes. These are organic compounds containing two or more linked thiophene rings. Thiophene is a five-member aromatic ring with one sulfur and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504767884 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767884 |
| IUPAC Name | 4-hexyl-2-(4-hexylthiophen-2-yl)thiophene |
| INCHI | InChI=1S/C20H30S2/c1-3-5-7-9-11-17-13-19(21-15-17)20-14-18(16-22-20)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | RYQPWKFBXWPBGB-UHFFFAOYSA-N |
| Smiles | CCCCCCC1=CSC(=C1)C2=CC(=CS2)CCCCCC |
| Isomeric SMILES | CCCCCCC1=CSC(=C1)C2=CC(=CS2)CCCCCC |
| Molecular Weight | 334.58 |
| Reaxy-Rn | 7297567 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=7297567&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 29, 2022 | D155812 | |
| Certificate of Analysis | Dec 29, 2022 | D155812 | |
| Certificate of Analysis | Dec 29, 2022 | D155812 |
| Sensitivity | Light Sensitive,Air Sensitive,Heat Sensitive |
|---|---|
| Refractive Index | 1.56 |
| Flash Point(°C) | 156 °C |
| Molecular Weight | 334.600 g/mol |
| XLogP3 | 8.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 11 |
| Exact Mass | 334.179 Da |
| Monoisotopic Mass | 334.179 Da |
| Topological Polar Surface Area | 56.500 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 251.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |