Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C180884-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,597.90
|
|
Discover 4-(4-Cyanophenyl)nicotinic acid by Aladdin Scientific in 96% for only $1,597.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(4-CYANOPHENYL)NICOTINIC ACID | 1261943-53-6 | 4-(4-cyanophenyl)pyridine-3-carboxylic acid | 4-(4-Cyanophenyl)nicotinicacid | DTXSID80692427 | MFCD18323329 | AKOS015892225 | BS-20276 | 3-Pyridinecarboxylic acid, 4-(4-cyanophenyl)- | A889549 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | Pyridinecarboxylic acids Benzonitriles Heteroaromatic compounds Nitriles Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 4-phenylpyridine - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Benzonitrile - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Carboxylic acid derivative - Carboxylic acid - Carbonitrile - Nitrile - Azacycle - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organopnictogen compound - Cyanide - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(4-cyanophenyl)pyridine-3-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C13H8N2O2/c14-7-9-1-3-10(4-2-9)11-5-6-15-8-12(11)13(16)17/h1-6,8H,(H,16,17) |
| InChIKey | JBDWRDZLMVIYDW-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C#N)C2=C(C=NC=C2)C(=O)O |
| Isomeric SMILES | C1=CC(=CC=C1C#N)C2=C(C=NC=C2)C(=O)O |
| PubChem CID | 53229153 |
| Molecular Weight | 224.2 |
| Molecular Weight | 224.210 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 224.059 Da |
| Monoisotopic Mass | 224.059 Da |
| Topological Polar Surface Area | 74.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 326.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |