Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C183125-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$799.90
|
|
Discover 4-(4-Chlorophenyl)-2-methylthiazole by Aladdin Scientific in 97% for only $799.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(4-Chlorophenyl)-2-methylthiazole | 24840-75-3 | 4-(4-chlorophenyl)-2-methyl-1,3-thiazole | 4-(4-Chloro-phenyl)-2-methyl-thiazole | Maybridge1_003478 | SCHEMBL2405184 | DTXSID60351383 | 2-methyl-4-(p-chlorophenyl)thiazole | MFCD00458172 | STK388163 | AKOS000115178 | CCG-1036 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2,4-disubstituted thiazoles |
| Alternative Parents | Chlorobenzenes Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2,4-disubstituted 1,3-thiazole - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Azacycle - Organohalogen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organopnictogen compound - Organochloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2,4-disubstituted thiazoles. These are compounds containing a thiazole ring substituted at the positions 2 and 3. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(4-chlorophenyl)-2-methyl-1,3-thiazole |
|---|---|
| INCHI | InChI=1S/C10H8ClNS/c1-7-12-10(6-13-7)8-2-4-9(11)5-3-8/h2-6H,1H3 |
| InChIKey | FOCILOSWFFTFNL-UHFFFAOYSA-N |
| Smiles | CC1=NC(=CS1)C2=CC=C(C=C2)Cl |
| Isomeric SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)Cl |
| Molecular Weight | 209.7 |
| Reaxy-Rn | 143962 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=143962&ln= |
| Molecular Weight | 209.700 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 209.007 Da |
| Monoisotopic Mass | 209.007 Da |
| Topological Polar Surface Area | 41.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 168.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |