Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B471927-25mg
|
25mg |
3
|
$401.90
|
|
|
B471927-100mg
|
100mg |
2
|
$1,134.90
|
|
| Synonyms | D98395 | 4,4 inverted exclamation marka-Dipyridyl-d8 | 4,4'-Bipyridyl-d8, 98 atom % D | 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuteriopyridin-4-yl)pyridine | 4,4'-Bipyridyl-d8 | HY-W017289S |
|---|---|
| Specifications & Purity | ≥98 atom% D,≥98% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Bipyridines and oligopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bipyridines and oligopyridines |
| Alternative Parents | Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Azacyclic compounds Aldimines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Bipyridine - Heteroaromatic compound - Azacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Aldimine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Imine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as bipyridines and oligopyridines. These are organic compounds containing two pyridine rings linked to each other. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuteriopyridin-4-yl)pyridine |
|---|---|
| INCHI | InChI=1S/C10H8N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | MWVTWFVJZLCBMC-PGRXLJNUSA-N |
| Smiles | C1=CN=CC=C1C2=CC=NC=C2 |
| Isomeric SMILES | [2H]C1=C(N=C(C(=C1C2=C(C(=NC(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
| UN Number | 2811 |
| Molecular Weight | 164.23 |
| Reaxy-Rn | 113176 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=113176&ln= |
| Sensitivity | Hygroscopic |
|---|---|
| Flash Point(°F) | Not applicable |
| Flash Point(°C) | Not applicable |
| Melt Point(°C) | 111-114℃ (lit.) |
| Molecular Weight | 164.230 g/mol |
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 164.119 Da |
| Monoisotopic Mass | 164.119 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 108.000 |
| Isotope Atom Count | 8 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |