Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A181943-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,175.90
|
|
Discover 4-(4-Aminophenyl)-N,N-dimethylbenzamide by Aladdin Scientific in 98% for only $1,175.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 166386-41-0 | 4-(4-Aminophenyl)-N,N-dimethylbenzamide | 4'-Amino-N,N-dimethyl-[1,1'-biphenyl]-4-carboxamide | SCHEMBL6492139 | [1,1'-Biphenyl]-4-carboxamide, 4'-amino-N,N-dimethyl- | DTXSID50716528 | MFCD20231502 | AKOS015888639 | SB77171 | BS-21678 | CS-0208816 | A882331 | 4'-a |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Biphenyls and derivatives |
| Alternative Parents | Benzamides Benzoyl derivatives Aniline and substituted anilines Tertiary carboxylic acid amides Amino acids and derivatives Primary amines Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Biphenyl - Benzamide - Benzoic acid or derivatives - Benzoyl - Aniline or substituted anilines - Tertiary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Carboxylic acid derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Amine - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as biphenyls and derivatives. These are organic compounds containing to benzene rings linked together by a C-C bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(4-aminophenyl)-N,N-dimethylbenzamide |
|---|---|
| INCHI | InChI=1S/C15H16N2O/c1-17(2)15(18)13-5-3-11(4-6-13)12-7-9-14(16)10-8-12/h3-10H,16H2,1-2H3 |
| InChIKey | UALKREGOHDLMRS-UHFFFAOYSA-N |
| Smiles | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N |
| Isomeric SMILES | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N |
| Molecular Weight | 240.3 |
| Reaxy-Rn | 2111383 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2111383&ln= |
| Molecular Weight | 240.300 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 240.126 Da |
| Monoisotopic Mass | 240.126 Da |
| Topological Polar Surface Area | 46.300 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 274.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |