1 Citations
D1818082Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | 8-(2-(4-(2-methoxyphenyl)piperazin-1-yl)ethyl)-8-azaspiro[4.5]decane-7,9-dione | MFCD00674043 | T2558 | AS-66898 | EINECS 214-595-1 | 3-(1-(3-(Dimethylamino)propyl)-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dione | Benzenamine, 4-methyl-N,N-bis(4-me |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organic nitrogen compounds
-
Class
Organonitrogen compounds
-
Subclass
Amines
- Level5 Tertiary amines
- Level6 Triarylamines
- Level5 Tertiary amines
-
Subclass
Amines
-
Class
Organonitrogen compounds
-
Superclass
Organic nitrogen compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | Aniline and substituted anilines Aminotoluenes Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tertiary aromatic amine - Aminotoluene - Aniline or substituted anilines - Toluene - Benzenoid - Monocyclic benzene moiety - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 504754585 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504754585 |
| IUPAC Name | 4-methyl-N,N-bis(4-methylphenyl)aniline |
| INCHI | InChI=1S/C21H21N/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | YXYUIABODWXVIK-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
| Isomeric SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
| WGK Germany | 3 |
| PubChem CID | 70873 |
| Molecular Weight | 287.4 |
| Beilstein | 12(4)1879 |
| Reaxy-Rn | 2215309 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Solubility | Soluble in chloroform and tetrahydrofuran (THF) |
|---|---|
| Boil Point(°C) | 170°C |
| Melt Point(°C) | 114-118°C |
| Molecular Weight | 287.400 g/mol |
| XLogP3 | 6.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 287.167 Da |
| Monoisotopic Mass | 287.167 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 262.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Citations of This Product
Solution Calculators
Reviews
Customer Reviews
Remind me later