Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D178850-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$728.90
|
|
Discover 4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenylboronic acid by Aladdin Scientific in 96% for only $728.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1025495-85-5 | (4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl)boronic acid | 4-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)PHENYLBORONIC ACID | [4-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid | [4-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]boronic acid | MFCD08572133 | SCHEMBL15332028 | DTXSID0 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | Benzene and substituted derivatives Heteroaromatic compounds Boronic acids Organic metalloid salts Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoboron compounds Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Boronic acid derivative - Boronic acid - Azacycle - Organic metalloid salt - Organic nitrogen compound - Organic salt - Hydrocarbon derivative - Organonitrogen compound - Organoboron compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid |
|---|---|
| INCHI | InChI=1S/C11H13BN2O2/c1-8-7-9(2)14(13-8)11-5-3-10(4-6-11)12(15)16/h3-7,15-16H,1-2H3 |
| InChIKey | OJUOPNGDUVRDFU-UHFFFAOYSA-N |
| Smiles | B(C1=CC=C(C=C1)N2C(=CC(=N2)C)C)(O)O |
| Isomeric SMILES | B(C1=CC=C(C=C1)N2C(=CC(=N2)C)C)(O)O |
| Molecular Weight | 216 |
| Reaxy-Rn | 40420471 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=40420471&ln= |
| Molecular Weight | 216.050 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 216.107 Da |
| Monoisotopic Mass | 216.107 Da |
| Topological Polar Surface Area | 58.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |