Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R171816-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,503.90
|
|
Discover 4-[(1R,2S)-rel-2-aminocyclopropyl]phenol by Aladdin Scientific in 97% for only $3,503.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-Hydroxytranylcypromine | 104777-77-7 | 4-[(1S,2R)-2-aminocyclopropyl]phenol | rac-4-[(1r,2s)-2-aminocyclopropyl]phenol | 4-[trans-2-Aminocyclopropyl]phenol | 4-Hydroxyphenylcyclopropanamine | Phenol, 4-(2-aminocyclopropyl)-, trans- | SCHEMBL1524385 | DTXSID90909199 | HAD |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
| Alternative Parents | Aralkylamines Benzene and substituted derivatives Organopnictogen compounds Organooxygen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 1-hydroxy-2-unsubstituted benzenoid - Aralkylamine - Monocyclic benzene moiety - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1-hydroxy-2-unsubstituted benzenoids. These are phenols that a unsubstituted at the 2-position. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[(1S,2R)-2-aminocyclopropyl]phenol |
|---|---|
| INCHI | InChI=1S/C9H11NO/c10-9-5-8(9)6-1-3-7(11)4-2-6/h1-4,8-9,11H,5,10H2/t8-,9+/m0/s1 |
| InChIKey | HADIWKXZWHXEDX-DTWKUNHWSA-N |
| Smiles | C1C(C1N)C2=CC=C(C=C2)O |
| Isomeric SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)O |
| PubChem CID | 128670 |
| Molecular Weight | 149.193 |
| Molecular Weight | 149.190 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 149.084 Da |
| Monoisotopic Mass | 149.084 Da |
| Topological Polar Surface Area | 46.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |