Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N346524-1mg
|
1mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$50.90
|
|
|
N346524-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$323.90
|
|
| Synonyms | AKOS040758952 | HY-D0033 | DTXSID60357360 | 4-((1H-Naphtho[2,3-d][1,2,3]triazol-1-yl)methyl)benzoic acid | J-100024 | CS-0009924 | 4-[(1-Naphto[2,3-d)triazol-1-yl)-methyl]benzoic acid | 4-(benzo[f]benzotriazol-3-ylmethyl)benzoic acid | AQ-405/42300372 | 4 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description |
4-[(1-Naphtho[2,3-d]triazol-1-yl)methyl]benzoic acid is a reference probe for the cell-permeable, non-fluorescent NO probe Ethyl 4-[(3-amino-2-naphthyl)aminomethyl]benzoate hydrochloride . |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Benzotriazoles Benzoic acids Benzoyl derivatives Triazoles Heteroaromatic compounds Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthalene - Benzoic acid or derivatives - Benzoic acid - Benzotriazole - Benzoyl - Monocyclic benzene moiety - Azole - Heteroaromatic compound - 1,2,3-triazole - Triazole - Azacycle - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organopnictogen compound - Organic oxide - Organonitrogen compound - Organooxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(benzo[f]benzotriazol-3-ylmethyl)benzoic acid |
|---|---|
| INCHI | InChI=1S/C18H13N3O2/c22-18(23)13-7-5-12(6-8-13)11-21-17-10-15-4-2-1-3-14(15)9-16(17)19-20-21/h1-10H,11H2,(H,22,23) |
| InChIKey | CPVINIGXGKJNOS-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C=C3C(=CC2=C1)N=NN3CC4=CC=C(C=C4)C(=O)O |
| Isomeric SMILES | C1=CC=C2C=C3C(=CC2=C1)N=NN3CC4=CC=C(C=C4)C(=O)O |
| Molecular Weight | 303.31 |
| Reaxy-Rn | 8924350 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8924350&ln= |
| Molecular Weight | 303.300 g/mol |
|---|---|
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 303.101 Da |
| Monoisotopic Mass | 303.101 Da |
| Topological Polar Surface Area | 68.000 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 436.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |