Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D179213-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,023.90
|
|
| Synonyms | 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid | 1072946-41-8 | [4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]boronic acid | (4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl)boronic acid | SCHEMBL15329598 | DTXSID00674548 | MFCD11053806 | AKOS015855720 | BS-22370 | CS-0174538 | D |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides 1,3-dioxolanes Boronic acids Oxacyclic compounds Organic metalloid salts Acetals Organometalloid compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Fluorobenzene - Aryl fluoride - Aryl halide - Meta-dioxolane - Boronic acid derivative - Boronic acid - Acetal - Oxacycle - Organic metalloid salt - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organohalogen compound - Organic metalloid moeity - Organofluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]boronic acid |
|---|---|
| INCHI | InChI=1S/C9H9BF2O4/c11-6-3-5(9-15-1-2-16-9)4-7(12)8(6)10(13)14/h3-4,9,13-14H,1-2H2 |
| InChIKey | GTBJZTQCEQYQLQ-UHFFFAOYSA-N |
| Smiles | B(C1=C(C=C(C=C1F)C2OCCO2)F)(O)O |
| Isomeric SMILES | B(C1=C(C=C(C=C1F)C2OCCO2)F)(O)O |
| PubChem CID | 46738900 |
| Molecular Weight | 230 |
| Molecular Weight | 229.980 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 230.056 Da |
| Monoisotopic Mass | 230.056 Da |
| Topological Polar Surface Area | 58.900 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |