Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S305196-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,291.90
|
|
| Synonyms | 176022-03-0 | 50373-13-2 | 3-Piperidinemethanol, 1-methyl-4-phenyl-, trans- | 3-Piperidinemethanol, 1-methyl-4-phenyl-, (3S,4R)- | [(3S,4R)-1-methyl-4-phenylpiperidin-3-yl]methanol | (trans-1-Methyl-4-phenylpiperidin-3-yl)methanol | (3S,4R)-1-Methyl-4-phenyl-3-piperi |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature,Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Phenylpiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpiperidines |
| Alternative Parents | Aralkylamines Benzene and substituted derivatives 1,3-aminoalcohols Trialkylamines Azacyclic compounds Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpiperidine - Aralkylamine - Monocyclic benzene moiety - Benzenoid - 1,3-aminoalcohol - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic oxygen compound - Alcohol - Primary alcohol - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Amine - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpiperidines. These are compounds containing a phenylpiperidine skeleton, which consists of a piperidine bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [(3S,4R)-1-methyl-4-phenylpiperidin-3-yl]methanol |
|---|---|
| INCHI | InChI=1S/C13H19NO/c1-14-8-7-13(12(9-14)10-15)11-5-3-2-4-6-11/h2-6,12-13,15H,7-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | PTRITADCAOWGKC-STQMWFEESA-N |
| Smiles | CN1CCC(C(C1)CO)C2=CC=CC=C2 |
| Isomeric SMILES | CN1CC[C@H]([C@@H](C1)CO)C2=CC=CC=C2 |
| PubChem CID | 9820015 |
| Molecular Weight | 205.3 |
| Molecular Weight | 205.300 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 205.147 Da |
| Monoisotopic Mass | 205.147 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 189.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |