Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R178511-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,752.90
|
|
| Synonyms | 955028-83-8 | (3R,4R)-rel-4-Fluoropiperidin-3-ol hydrochloride | (3R,4R)-rel-4-Fluoro-3-piperidinol hydrochloride | (3R,4R)-4-fluoropiperidin-3-ol;hydrochloride | trans-4-Fluoro-3-piperidinol HCl | trans-4-Fluoro-piperidin-3-ol hydrochloride | (3R,4R)-4-fluoropiperid |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Secondary alcohols Fluorohydrins 1,2-aminoalcohols Dialkylamines Azacyclic compounds Organofluorides Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - 1,2-aminoalcohol - Fluorohydrin - Halohydrin - Secondary alcohol - Secondary aliphatic amine - Azacycle - Secondary amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrochloride - Hydrocarbon derivative - Organic oxygen compound - Amine - Alkyl halide - Alkyl fluoride - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3R,4R)-4-fluoropiperidin-3-ol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C5H10FNO.ClH/c6-4-1-2-7-3-5(4)8;/h4-5,7-8H,1-3H2;1H/t4-,5-;/m1./s1 |
| InChIKey | CGOYYYHEMMLYLM-TYSVMGFPSA-N |
| Smiles | C1CNCC(C1F)O.Cl |
| Isomeric SMILES | C1CNC[C@H]([C@@H]1F)O.Cl |
| PubChem CID | 67087324 |
| Molecular Weight | 155.6 |
| Molecular Weight | 155.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 155.051 Da |
| Monoisotopic Mass | 155.051 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 78.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |