Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T166711-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$761.90
|
|
| Synonyms | 3-((Trimethylsilyl)ethynyl)-1,5-naphthyridine | 1246088-67-4 | trimethyl-[2-(1,5-naphthyridin-3-yl)ethynyl]silane | 3-[(Trimethylsilyl)ethynyl]-1,5-naphthyridine | 3-[2-(trimethylsilyl)ethynyl]-1,5-naphthyridine | DTXSID10678411 | WZB08867 | MFCD17171336 | AKOS015840178 | |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridines |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Trialkylsilanes Organic metalloid salts Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine - Pyridine - Heteroaromatic compound - Trialkylsilane - Azacycle - Organic metalloid salt - Organic nitrogen compound - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Organonitrogen compound - Organic metalloid moeity - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridines. These are compounds containing a naphthyridine moiety, a naphthalene in which a carbon atom has been replaced by a nitrogen in each of the two rings. The naphthyridine skeleton can also be described as an assembly two fused pyridine rings, which do not share their nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | trimethyl-[2-(1,5-naphthyridin-3-yl)ethynyl]silane |
|---|---|
| INCHI | InChI=1S/C13H14N2Si/c1-16(2,3)8-6-11-9-13-12(15-10-11)5-4-7-14-13/h4-5,7,9-10H,1-3H3 |
| InChIKey | NQZJFDDEKHPDJF-UHFFFAOYSA-N |
| Smiles | C[Si](C)(C)C#CC1=CC2=C(C=CC=N2)N=C1 |
| Isomeric SMILES | C[Si](C)(C)C#CC1=CC2=C(C=CC=N2)N=C1 |
| PubChem CID | 49761607 |
| Molecular Weight | 226.35 |
| Molecular Weight | 226.350 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 226.093 Da |
| Monoisotopic Mass | 226.093 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 307.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |