Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T116076-1g
|
1g |
3
|
$9.90
|
|
|
T116076-5g
|
5g |
3
|
$36.90
|
|
|
T116076-25g
|
25g |
4
|
$112.90
|
|
|
T116076-100g
|
100g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$403.90
|
|
| Synonyms | T1615 | DTXSID90369815 | SCHEMBL224912 | m-(trifluoromethoxy)phenol | FT-0613914 | MFCD00040987 | 3-(Tifluoromethoxy)phenol | Phenol, 3-(trifluoromethoxy)- | 3-trifluoromethoxyphenol | 3-Trifluoromethoxy-phenol | PS-8562 | STL554620 | AKOS005145713 | CS-W |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds 1-hydroxy-4-unsubstituted benzenoids 1-hydroxy-2-unsubstituted benzenoids Trihalomethanes Organooxygen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Monocyclic benzene moiety - Trihalomethane - Alkyl fluoride - Hydrocarbon derivative - Halomethane - Organooxygen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488192367 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488192367 |
| IUPAC Name | 3-(trifluoromethoxy)phenol |
| INCHI | InChI=1S/C7H5F3O2/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4,11H |
| InChIKey | UWLJERQTLRORJN-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC(=C1)OC(F)(F)F)O |
| Isomeric SMILES | C1=CC(=CC(=C1)OC(F)(F)F)O |
| WGK Germany | 3 |
| PubChem CID | 2733261 |
| Molecular Weight | 178.11 |
| Reaxy-Rn | 1868036 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 22, 2024 | T116076 | |
| Certificate of Analysis | Aug 22, 2024 | T116076 | |
| Certificate of Analysis | Aug 22, 2024 | T116076 | |
| Certificate of Analysis | Aug 22, 2024 | T116076 | |
| Certificate of Analysis | Feb 21, 2024 | T116076 | |
| Certificate of Analysis | Feb 21, 2024 | T116076 | |
| Certificate of Analysis | Feb 21, 2024 | T116076 | |
| Certificate of Analysis | Feb 25, 2022 | T116076 |
| Refractive Index | 1.45 |
|---|---|
| Flash Point(°F) | 184 °F |
| Flash Point(°C) | 184°F |
| Boil Point(°C) | 69-70°C |
| Melt Point(°C) | 69-70°C |
| Molecular Weight | 178.110 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 178.024 Da |
| Monoisotopic Mass | 178.024 Da |
| Topological Polar Surface Area | 29.500 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 146.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |