Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P165874-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,735.90
|
|
| Synonyms | 109221-90-1 | (3-phenoxyphenyl)hydrazine hydrochloride | (3-PHENOXY-PHENYL)-HYDRAZINE HYDROCHLORIDE | (3-phenoxyphenyl)hydrazine;hydrochloride | (3-Phenoxyphenyl)hydrazine HCl | (3-Phenoxy-phenyl)-hydrazine HCl | SCHEMBL4376342 | AB9886 | MFCD06738786 | (3-phenoxyphenyl)hy |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylethers |
| Alternative Parents | Diarylethers Phenylhydrazines Phenoxy compounds Phenol ethers Organopnictogen compounds Hydrochlorides Hydrocarbon derivatives Hydrazines and derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylether - Diaryl ether - Phenoxy compound - Phenylhydrazine - Phenol ether - Ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Organooxygen compound - Organonitrogen compound - Hydrazine derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-phenoxyphenyl)hydrazine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C12H12N2O.ClH/c13-14-10-5-4-8-12(9-10)15-11-6-2-1-3-7-11;/h1-9,14H,13H2;1H |
| InChIKey | ASGHYEJXROPEMM-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)OC2=CC=CC(=C2)NN.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)NN.Cl |
| PubChem CID | 53420705 |
| Molecular Weight | 236.7 |
| Molecular Weight | 236.700 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 236.072 Da |
| Monoisotopic Mass | 236.072 Da |
| Topological Polar Surface Area | 47.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 180.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |