Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N637438-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$311.90
|
|
| Synonyms | SCHEMBL3790051 | AS-54707 | AC-28041 | AKOS015909652 | 3-Nitro-1H-pyrazolo[3,4-b]pyridine | 1H-Pyrazolo[3,4-b]pyridine,3-nitro- | J-512958 | A853786 | TD8029 | 1H-PYRAZOLO[3,4-B]PYRIDINE, 3-NITRO- | PB22574 | CS-0030470 | 3-NITRO-1H-PYRAZOLO[3,4-B]PYRIDIN |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrazolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolopyridines |
| Alternative Parents | Nitroaromatic compounds Pyridines and derivatives Imidolactams Pyrazoles Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organonitrogen compounds Organic zwitterions Organic salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrazolopyridine - Nitroaromatic compound - Pyridine - Imidolactam - Azole - Pyrazole - Heteroaromatic compound - Organic nitro compound - C-nitro compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic oxoazanium - Azacycle - Organic oxide - Organic salt - Organic zwitterion - Organic oxygen compound - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolopyridines. These are compounds containing a pyrazolopyridine skeleton, which consists of a pyrazole fused to a pyridine. Pyrazole is 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. Pyridine is a 6-membered ring with four carbon and one nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-nitro-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| INCHI | InChI=1S/C6H4N4O2/c11-10(12)6-4-2-1-3-7-5(4)8-9-6/h1-3H,(H,7,8,9) |
| InChIKey | BAUHQAOOAIVBTO-UHFFFAOYSA-N |
| Smiles | C1=CC2=C(NN=C2N=C1)[N+](=O)[O-] |
| Isomeric SMILES | C1=CC2=C(NN=C2N=C1)[N+](=O)[O-] |
| Alternate CAS | 116855-00-6 |
| PubChem CID | 86327327 |
| Molecular Weight | 164.12 |
| Molecular Weight | 164.120 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 164.033 Da |
| Monoisotopic Mass | 164.033 Da |
| Topological Polar Surface Area | 87.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |