Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M174600-250mg
|
250mg |
2
|
$344.90
|
|
|
M174600-1g
|
1g |
1
|
$1,030.90
|
|
| Synonyms | (3-methylpyrazin-2-yl)methanol | 160818-32-6 | 2-(Hydroxymethyl)-3-methylpyrazine | 2-Pyrazinemethanol, 3-methyl- | MFCD09834939 | 3-Methyl-2-pyrazinylmethanol | 2-?(Hydroxymethyl)?-?3-?methylpyrazine | 3-Methylpyrazine-2-methanol | 3-methyl-2-pyrazinyl-methanol | SCHEMBL7 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Primary alcohols Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-methylpyrazin-2-yl)methanol |
|---|---|
| INCHI | InChI=1S/C6H8N2O/c1-5-6(4-9)8-3-2-7-5/h2-3,9H,4H2,1H3 |
| InChIKey | PIDARGGCVNDISL-UHFFFAOYSA-N |
| Smiles | CC1=NC=CN=C1CO |
| Isomeric SMILES | CC1=NC=CN=C1CO |
| Molecular Weight | 124.143 |
| Reaxy-Rn | 32472621 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=32472621&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 04, 2023 | M174600 | |
| Certificate of Analysis | Dec 04, 2023 | M174600 | |
| Certificate of Analysis | Dec 04, 2023 | M174600 |
| Molecular Weight | 124.140 g/mol |
|---|---|
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 124.064 Da |
| Monoisotopic Mass | 124.064 Da |
| Topological Polar Surface Area | 46.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 87.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |