Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M172371-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$265.90
|
|
Discover 3-methyl-1H-pyrazolo[3,4-b]pyridin-5-amine by Aladdin Scientific in 97% for only $265.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3-methyl-1H-pyrazolo[3,4-b]pyridin-5-amine | 1186608-73-0 | 3-methyl-2H-pyrazolo[3,4-b]pyridin-5-amine | 5-AMINO-3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE | 3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-AMINE | SCHEMBL1593072 | DTXSID80677613 | YMIOCQRPGZZJIL-UHFFFAOYSA-N | AMY33880 | M |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrazolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolopyridines |
| Alternative Parents | Aminopyridines and derivatives Pyrazoles Heteroaromatic compounds Azacyclic compounds Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrazolopyridine - Aminopyridine - Pyridine - Heteroaromatic compound - Pyrazole - Azole - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolopyridines. These are compounds containing a pyrazolopyridine skeleton, which consists of a pyrazole fused to a pyridine. Pyrazole is 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. Pyridine is a 6-membered ring with four carbon and one nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-methyl-2H-pyrazolo[3,4-b]pyridin-5-amine |
|---|---|
| INCHI | InChI=1S/C7H8N4/c1-4-6-2-5(8)3-9-7(6)11-10-4/h2-3H,8H2,1H3,(H,9,10,11) |
| InChIKey | YMIOCQRPGZZJIL-UHFFFAOYSA-N |
| Smiles | CC1=C2C=C(C=NC2=NN1)N |
| Isomeric SMILES | CC1=C2C=C(C=NC2=NN1)N |
| PubChem CID | 47002169 |
| Molecular Weight | 148.169 |
| Molecular Weight | 148.170 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 148.075 Da |
| Monoisotopic Mass | 148.075 Da |
| Topological Polar Surface Area | 67.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |