Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M589093-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$31.90
|
|
|
M589093-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$85.90
|
|
| Synonyms | 3-methoxypropionic acid chloride | 3-Methoxypropionyl chloride | 3-methoxy-propionyl chloride | 3-methoxy-propionyl chloride, AldrichCPR | 3-(methyloxy)propanoyl chloride | JSMDUOFOPDSKIQ-UHFFFAOYSA-N | SCHEMBL56801 | SY147737 | MFCD03424697 | methoxyprop |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Acyl halides |
| Subclass | Acyl chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acyl chlorides |
| Alternative Parents | Dialkyl ethers Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Ether - Dialkyl ether - Acyl chloride - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as acyl chlorides. These are organic compounds containing the functional group -CO-Cl. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-methoxypropanoyl chloride |
|---|---|
| INCHI | InChI=1S/C4H7ClO2/c1-7-3-2-4(5)6/h2-3H2,1H3 |
| InChIKey | JSMDUOFOPDSKIQ-UHFFFAOYSA-N |
| Smiles | COCCC(=O)Cl |
| Isomeric SMILES | COCCC(=O)Cl |
| Molecular Weight | 122.55 |
| Reaxy-Rn | 1743019 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1743019&ln= |
| Sensitivity | Moisture sensitive |
|---|---|
| Molecular Weight | 122.550 g/mol |
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 122.013 Da |
| Monoisotopic Mass | 122.013 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 62.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |