Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M628642-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$324.90
|
|
|
M628642-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$503.90
|
|
|
M628642-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,515.90
|
|
| Synonyms | SB20838 | 1368181-72-9 | AKOS022714367 | MFCD22068858 | 5-Amino-3-methoxy-1H-indazole | 3-Methoxy-1H-indazol-5-amine | P13054 | 1h-indazol-5-amine,3-methoxy- | CS-0051295 | AS-51598 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrazoles |
| Subclass | Indazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indazoles |
| Alternative Parents | Alkyl aryl ethers Benzenoids Pyrazoles Heteroaromatic compounds Azacyclic compounds Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzopyrazole - Indazole - Alkyl aryl ether - Benzenoid - Azole - Heteroaromatic compound - Pyrazole - Ether - Azacycle - Organonitrogen compound - Amine - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Primary amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indazoles. These are compounds containing an indazole, which is structurally characterized by a pyrazole fused to a benzene. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-methoxy-1H-indazol-5-amine |
|---|---|
| INCHI | InChI=1S/C8H9N3O/c1-12-8-6-4-5(9)2-3-7(6)10-11-8/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | VKRAQIYBQWNRSL-UHFFFAOYSA-N |
| Smiles | COC1=NNC2=C1C=C(C=C2)N |
| Isomeric SMILES | COC1=NNC2=C1C=C(C=C2)N |
| Alternate CAS | 1368181-72-9 |
| PubChem CID | 74891104 |
| Molecular Weight | 163.18 |
| Molecular Weight | 163.180 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 163.075 Da |
| Monoisotopic Mass | 163.075 Da |
| Topological Polar Surface Area | 63.900 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 164.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |