Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H177612-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$612.90
|
|
| Synonyms | 3-(Hydroxymethyl)piperidin-3-ol | 848069-91-0 | 3-(hydroxymethyl)-3-piperidinol | 3-hydroxymethylpiperidin-3-ol | SCHEMBL6370752 | 3-Hydroxymethyl-piperidin-3-ol | DTXSID10717637 | RNGTVNNILWIEBH-UHFFFAOYSA-N | YIB06991 | AKOS006376533 | AM101344 | CS-0051682 | EN300-251397 | A863 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Tertiary alcohols 1,3-aminoalcohols 1,2-diols 1,2-aminoalcohols Dialkylamines Azacyclic compounds Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidine - 1,3-aminoalcohol - Tertiary alcohol - 1,2-aminoalcohol - 1,2-diol - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Primary alcohol - Amine - Alcohol - Hydrocarbon derivative - Organic oxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(hydroxymethyl)piperidin-3-ol |
|---|---|
| INCHI | InChI=1S/C6H13NO2/c8-5-6(9)2-1-3-7-4-6/h7-9H,1-5H2 |
| InChIKey | RNGTVNNILWIEBH-UHFFFAOYSA-N |
| Smiles | C1CC(CNC1)(CO)O |
| Isomeric SMILES | C1CC(CNC1)(CO)O |
| Molecular Weight | 131.17 |
| Reaxy-Rn | 14372473 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14372473&ln= |
| Molecular Weight | 131.170 g/mol |
|---|---|
| XLogP3 | -1.200 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 131.095 Da |
| Monoisotopic Mass | 131.095 Da |
| Topological Polar Surface Area | 52.500 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 97.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |