Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C194982-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$540.90
|
|
| Synonyms | 3-(Chloromethyl)isoquinoline hydrochloride | 76884-33-8 | 3-(chloromethyl)isoquinoline;hydrochloride | 3-chloromethylisoquinoline hydrochloride | 3-(Chloromethyl)isoquinolinehydrochloride | SCHEMBL9253127 | DTXSID40512117 | YETGNODBVXTTEB-UHFFFAOYSA-N | BDA88433 | AKOS0160 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Isoquinolines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoquinolines and derivatives |
| Alternative Parents | Pyridines and derivatives Benzenoids Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoquinoline - Benzenoid - Pyridine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as isoquinolines and derivatives. These are aromatic polycyclic compounds containing an isoquinoline moiety, which consists of a benzene ring fused to a pyridine ring and forming benzo[c]pyridine. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(chloromethyl)isoquinoline;hydrochloride |
|---|---|
| INCHI | InChI=1S/C10H8ClN.ClH/c11-6-10-5-8-3-1-2-4-9(8)7-12-10;/h1-5,7H,6H2;1H |
| InChIKey | YETGNODBVXTTEB-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C=NC(=CC2=C1)CCl.Cl |
| Isomeric SMILES | C1=CC=C2C=NC(=CC2=C1)CCl.Cl |
| PubChem CID | 12874871 |
| Molecular Weight | 214.09 |
| Molecular Weight | 214.090 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 213.011 Da |
| Monoisotopic Mass | 213.011 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |