Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C172695-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$137.90
|
|
| Synonyms | 3-(Chloromethyl)-5-fluoropyridine hydrochloride | 1222556-83-3 | 3-(Chloromethyl)-5-fluoropyridine HCl | 3-(chloromethyl)-5-fluoropyridine;hydrochloride | MFCD19687170 | Pyridine, 3-(chloromethyl)-5-fluoro-, hydrochloride (1:1) | SCHEMBL2304179 | PFOZTYJEKXOWQS-UHFFFAO |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Aryl fluorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Organochlorides Hydrochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Aryl halide - Aryl fluoride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(chloromethyl)-5-fluoropyridine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H5ClFN.ClH/c7-2-5-1-6(8)4-9-3-5;/h1,3-4H,2H2;1H |
| InChIKey | PFOZTYJEKXOWQS-UHFFFAOYSA-N |
| Smiles | C1=C(C=NC=C1F)CCl.Cl |
| Isomeric SMILES | C1=C(C=NC=C1F)CCl.Cl |
| PubChem CID | 56776453 |
| Molecular Weight | 182.02 |
| Molecular Weight | 182.020 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 180.986 Da |
| Monoisotopic Mass | 180.986 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 89.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |