Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B180630-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$63.90
|
|
Discover 3-Butoxy-5-(trifluoromethoxy)phenylboronic acid by Aladdin Scientific in 97% for only $63.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1256345-96-6 | 3-BUTOXY-5-(TRIFLUOROMETHOXY)PHENYLBORONIC ACID | (3-Butoxy-5-(trifluoromethoxy)phenyl)boronic acid | [3-butoxy-5-(trifluoromethoxy)phenyl]boronic acid | (3-Butoxy-5-(trifluoromethoxy)phenyl)boronicacid | DTXSID80681634 | LJAITWONDCKJGB-UHFFFAOYSA-N | MF |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Alkyl aryl ethers Trihalomethanes Boronic acids Organic metalloid salts Organometalloid compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Monocyclic benzene moiety - Trihalomethane - Boronic acid derivative - Boronic acid - Organic metalloid salt - Ether - Organic metalloid moeity - Organohalogen compound - Alkyl fluoride - Organic oxygen compound - Hydrocarbon derivative - Halomethane - Alkyl halide - Organofluoride - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [3-butoxy-5-(trifluoromethoxy)phenyl]boronic acid |
|---|---|
| INCHI | InChI=1S/C11H14BF3O4/c1-2-3-4-18-9-5-8(12(16)17)6-10(7-9)19-11(13,14)15/h5-7,16-17H,2-4H2,1H3 |
| InChIKey | LJAITWONDCKJGB-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=CC(=C1)OC(F)(F)F)OCCCC)(O)O |
| Isomeric SMILES | B(C1=CC(=CC(=C1)OC(F)(F)F)OCCCC)(O)O |
| PubChem CID | 53216392 |
| Molecular Weight | 278 |
| Molecular Weight | 278.030 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 6 |
| Exact Mass | 278.094 Da |
| Monoisotopic Mass | 278.094 Da |
| Topological Polar Surface Area | 58.900 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 263.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |