Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B165455-1g
|
1g |
2
|
$58.90
|
|
|
B165455-5g
|
5g |
1
|
$216.90
|
|
|
B165455-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$861.90
|
|
| Synonyms | EINECS 213-808-5 | A19533 | AMY6637 | DTXSID10144045 | Phenyl(3-bromophenyl) ketone | MFCD00672015 | Z385416902 | 3-Bromobenzophenone | EN300-250756 | (3-bromophenyl)(phenyl)methanone | SCHEMBL40538 | Methanone, (3-bromophenyl)phenyl- | FT-0602307 | XNUMU |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzophenones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzophenones |
| Alternative Parents | Diphenylmethanes Aryl-phenylketones Benzoyl derivatives Bromobenzenes Aryl bromides Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzophenone - Diphenylmethane - Aryl-phenylketone - Benzoyl - Aryl ketone - Halobenzene - Bromobenzene - Aryl halide - Aryl bromide - Ketone - Organooxygen compound - Organobromide - Organohalogen compound - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzophenones. These are organic compounds containing a ketone attached to two phenyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-bromophenyl)-phenylmethanone |
|---|---|
| INCHI | InChI=1S/C13H9BrO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H |
| InChIKey | XNUMUNIJQMSNNN-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Br |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Br |
| WGK Germany | 3 |
| Molecular Weight | 261.11 |
| Reaxy-Rn | 2047053 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2047053&ln= |
| Melt Point(°C) | 74-78℃ |
|---|---|
| Molecular Weight | 261.110 g/mol |
| XLogP3 | 4.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 259.984 Da |
| Monoisotopic Mass | 259.984 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 221.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |