Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B136592-1g
|
1g |
7
|
$18.90
|
|
|
B136592-5g
|
5g |
5
|
$81.90
|
|
|
B136592-25g
|
25g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$365.90
|
|
|
B136592-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,315.90
|
|
| Synonyms | m-Bromobenzohydrazide | STK249315 | 3-Bromobenzohydrazide | AM20040354 | UNII-V13007Z41A | EN300-91874 | (m-Bromobenzoyl)hydrazine | 5-(4-Methylbenzyl)-2-furoicacid | EINECS 254-298-4 | F8881-5843 | FT-0615202 | BCP23133 | Benzoic acid, 3-bromo-, hydrazid |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Halobenzoic acids and derivatives |
| Direct Parent | 3-halobenzoic acids and derivatives |
| Alternative Parents | Benzoyl derivatives Bromobenzenes Aryl bromides Carboxylic acid hydrazides Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 3-halobenzoic acid or derivatives - Benzoyl - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Carboxylic acid hydrazide - Carboxylic acid derivative - Organic nitrogen compound - Organobromide - Organohalogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 3-halobenzoic acids and derivatives. These are benzoic acids or derivatives carrying a halogen atom at the 3-position of the benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488190085 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488190085 |
| IUPAC Name | 3-bromobenzohydrazide |
| INCHI | InChI=1S/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | BNAQRAZIPAHWAR-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC(=C1)Br)C(=O)NN |
| Isomeric SMILES | C1=CC(=CC(=C1)Br)C(=O)NN |
| WGK Germany | 3 |
| Molecular Weight | 215.05 |
| Reaxy-Rn | 1945814 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1945814&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Oct 10, 2024 | B136592 | |
| Certificate of Analysis | Mar 18, 2023 | B136592 | |
| Certificate of Analysis | Sep 03, 2022 | B136592 |
| Melt Point(°C) | 157 °C |
|---|---|
| Molecular Weight | 215.050 g/mol |
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 213.974 Da |
| Monoisotopic Mass | 213.974 Da |
| Topological Polar Surface Area | 55.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 151.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |