Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
W132082-200mg
|
200mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$17.90
|
|
|
W132082-1g
|
1g |
3
|
$69.90
|
|
|
W132082-5g
|
5g |
3
|
$310.90
|
|
|
W132082-25g
|
25g |
3
|
$1,398.90
|
|
|
W132082-100g
|
100g |
2
|
$5,034.90
|
|
| Synonyms | SCHEMBL131414 | 1-Bromoadamantane-3-carboxylic acid | CCG-247256 | HMS557G02 | Z56757155 | BBL033826 | F0035-0448 | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-bromo- | AKOS000114514 | W-201896 | Maybridge1_005590 | SY018895 | 3-bromoadamantane-1-carb |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl bromides |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organobromide - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl bromide - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acids. These are compounds containing a carboxylic acid group with the formula -C(=O)OH. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504753416 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753416 |
| IUPAC Name | 3-bromoadamantane-1-carboxylic acid |
| INCHI | InChI=1S/C11H15BrO2/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H,13,14) |
| InChIKey | DJUDQBVINJIMFO-UHFFFAOYSA-N |
| Smiles | C1C2CC3(CC1CC(C2)(C3)Br)C(=O)O |
| Isomeric SMILES | C1C2CC3(CC1CC(C2)(C3)Br)C(=O)O |
| WGK Germany | 3 |
| RTECS | AU4452500 |
| PubChem CID | 30818 |
| Molecular Weight | 259.14 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 09, 2025 | W132082 | |
| Certificate of Analysis | Jul 09, 2025 | W132082 | |
| Certificate of Analysis | Jul 09, 2025 | W132082 | |
| Certificate of Analysis | Apr 10, 2024 | W132082 | |
| Certificate of Analysis | Apr 10, 2024 | W132082 | |
| Certificate of Analysis | Jul 17, 2023 | W132082 |
| Melt Point(°C) | 146-150℃ |
|---|---|
| Molecular Weight | 259.140 g/mol |
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 258.026 Da |
| Monoisotopic Mass | 258.026 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 286.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |