Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B171010-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$300.90
|
|
Discover (3-Benzyloxy-phenyl)-hydrazine hydrochloride by Aladdin Scientific in for only $300.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 59146-68-8 | (3-(Benzyloxy)phenyl)hydrazine hydrochloride | 56468-67-8 | 3-Benzyloxyphenylhydrazine hydrochloride | (3-benzyloxy-phenyl)-hydrazine hydrochloride | 3-Benzyloxyphenylhydrazine HCl | [3-(benzyloxy)phenyl]hydrazine hydrochloride | (3-phenylmethoxyphenyl)hyd |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylhydrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylhydrazines |
| Alternative Parents | Phenoxy compounds Phenol ethers Alkyl aryl ethers Hydrochlorides Hydrocarbon derivatives Hydrazines and derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenylhydrazine - Phenol ether - Alkyl aryl ether - Ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Organooxygen compound - Organonitrogen compound - Hydrazine derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylhydrazines. These are compounds containing a phenylhydrazide moiety, which consists of a hydrazide substituent attached to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-phenylmethoxyphenyl)hydrazine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C13H14N2O.ClH/c14-15-12-7-4-8-13(9-12)16-10-11-5-2-1-3-6-11;/h1-9,15H,10,14H2;1H |
| InChIKey | MMMGCMOISVZVKZ-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)COC2=CC=CC(=C2)NN.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)NN.Cl |
| Molecular Weight | 250.72 |
| Reaxy-Rn | 8087936 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8087936&ln= |
| Molecular Weight | 250.720 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 250.087 Da |
| Monoisotopic Mass | 250.087 Da |
| Topological Polar Surface Area | 47.300 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |