Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A173265-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,919.90
|
|
Discover (3-aminocyclobutyl)methanol hydrochloride by Aladdin Scientific in 97% for only $2,919.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 130369-06-1 | 142733-65-1 | 1284250-10-7 | 3-Amino-cyclobutanemethanol hydrochloride | cis-3-Amino-cyclobutanemethanol hydrochloride | (3-aminocyclobutyl)methanol hydrochloride | TRANS-3-AMINO-CYCLOBUTANEMETHANOL HYDROCHLORIDE | (cis-3-Aminocyclobutyl)methanol hydrochl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Primary alcohols |
| Alternative Parents | Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Primary alcohol - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as primary alcohols. These are compounds comprising the primary alcohol functional group, with the general structure RCOH (R=alkyl, aryl). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-aminocyclobutyl)methanol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C5H11NO.ClH/c6-5-1-4(2-5)3-7;/h4-5,7H,1-3,6H2;1H |
| InChIKey | NGVZDZFNCCGDGQ-UHFFFAOYSA-N |
| Smiles | C1C(CC1N)CO.Cl |
| Isomeric SMILES | C1C(CC1N)CO.Cl |
| Molecular Weight | 137.61 |
| Reaxy-Rn | 13865266 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13865266&ln= |
| Molecular Weight | 137.610 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 137.061 Da |
| Monoisotopic Mass | 137.061 Da |
| Topological Polar Surface Area | 46.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 59.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |