Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A730060-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$271.90
|
|
|
A730060-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$691.90
|
|
| Specifications & Purity | ≥97% |
|---|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxamides |
| Alternative Parents | Aminopiperidines Ureas Azacyclic compounds Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 1-piperidinecarboxamide - Piperidinecarboxamide - 3-aminopiperidine - Urea - Azacycle - Amine - Hydrocarbon derivative - Organic oxide - Primary amine - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Carbonyl group - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxamides. These are compounds containing a piperidine ring substituted with a carboxamide functional group. |
| External Descriptors | Not available |
|
|
|
| ALogP | -0.7 |
|---|
| IUPAC Name | 3-amino-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| INCHI | InChI=1S/C8H17N3O/c1-10(2)8(12)11-5-3-4-7(9)6-11/h7H,3-6,9H2,1-2H3 |
| InChIKey | ZSKQKQLNOZOOFP-UHFFFAOYSA-N |
| Smiles | CN(C)C(=O)N1CCCC(C1)N |
| Isomeric SMILES | CN(C)C(=O)N1CCCC(C1)N |
| PubChem CID | 21482877 |
| Molecular Weight | 171.24 |
| Molecular Weight | 171.240 g/mol |
|---|---|
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 171.137 Da |
| Monoisotopic Mass | 171.137 Da |
| Topological Polar Surface Area | 49.600 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 170.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |