Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A135384-1g
|
1g |
2
|
$68.90
|
|
| Synonyms | 3-Allyl-2-hydroxybenzaldehyde | 24019-66-7 | 3-Allylsalicylaldehyde | 3-Allyl-2-hydroxy-benzaldehyde | 2-hydroxy-3-prop-2-enylbenzaldehyde | Benzaldehyde, 2-hydroxy-3-(2-propenyl)- | Salicylaldehyde, 3-allyl- | 2-hydroxy-3-(prop-2-en-1-yl)benzaldehyde | MFCD00037364 | 3-Al |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Aldehydes - Aryl-aldehydes - Benzaldehydes |
| Direct Parent | Hydroxybenzaldehydes |
| Alternative Parents | Benzoyl derivatives 1-hydroxy-4-unsubstituted benzenoids Vinylogous acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Hydroxybenzaldehyde - Benzoyl - 1-hydroxy-4-unsubstituted benzenoid - Phenol - Benzenoid - Monocyclic benzene moiety - Vinylogous acid - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydroxybenzaldehydes. These are organic aromatic compounds containing a benzene ring carrying an aldehyde group and a hydroxyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504757223 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504757223 |
| IUPAC Name | 2-hydroxy-3-prop-2-enylbenzaldehyde |
| INCHI | InChI=1S/C10H10O2/c1-2-4-8-5-3-6-9(7-11)10(8)12/h2-3,5-7,12H,1,4H2 |
| InChIKey | INLWEXRRMUMHKB-UHFFFAOYSA-N |
| Smiles | C=CCC1=C(C(=CC=C1)C=O)O |
| Isomeric SMILES | C=CCC1=C(C(=CC=C1)C=O)O |
| WGK Germany | 3 |
| Molecular Weight | 162.19 |
| Reaxy-Rn | 1937672 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1937672&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 19, 2023 | A135384 |
| Solubility | Soluble in chloroform |
|---|---|
| Sensitivity | Air Sensitive |
| Refractive Index | 1.5645 |
| Flash Point(°F) | 222.8 °F |
| Flash Point(°C) | 106 °C |
| Molecular Weight | 162.180 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 162.068 Da |
| Monoisotopic Mass | 162.068 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 165.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |